Online Database of Chemicals from Around the World
|
CAS#: 40702-21-4 Product: Lithium Cyclohexanepropionate No suppilers available for the product. |
| Name | Lithium Cyclohexanepropionate |
|---|---|
| Synonyms | Lithium 2-Cyclohexylpropionate; Lithium Cyclohexanepropionate |
| Molecular Structure |  |
| Molecular Formula | C9H15LiO2 |
| Molecular Weight | 162.16 |
| CAS Registry Number | 40702-21-4 |
| EINECS | 255-045-0 |
| SMILES | CC(C1CCCCC1)C([O-])=O.[Li+] |
| InChI | 1S/C9H16O2.Li/c1-7(9(10)11)8-5-3-2-4-6-8;/h7-8H,2-6H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | FHTCZLJPRPJAAL-UHFFFAOYSA-M |
| Boiling point | 259.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium Cyclohexanepropionate |