Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,2'-[Methylenebis(Sulphonyl)]Bisethanol |
|---|---|
| Synonyms | Bis(2-Hydroxyethylsulfonyl)Methane; Bis(Hydroxyethylsulfonyl)Methane |
| Molecular Structure | ![CAS#: 41123-69-7， 2,2'-[Methylenebis(Sulphonyl)]Bisethanol](/moreStructures/41123-69-7.gif) |
| Molecular Formula | C5H12O6S2 |
| Molecular Weight | 232.27 |
| CAS Registry Number | 41123-69-7 |
| EINECS | 255-232-7 |
| SMILES | C([S](=O)(=O)C[S](=O)(=O)CCO)CO |
| InChI | 1S/C5H12O6S2/c6-1-3-12(8,9)5-13(10,11)4-2-7/h6-7H,1-5H2 |
| InChIKey | FBKUSAIWUANQNH-UHFFFAOYSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 628.159°C at 760 mmHg (Cal.) |
| Flash point | 333.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[Methylenebis(Sulphonyl)]Bisethanol |