Online Database of Chemicals from Around the World
|
CAS#: 41235-53-4 Product: D-11-Aza-19-Nortestosterone No suppilers available for the product. |
| Name | D-11-Aza-19-Nortestosterone |
|---|---|
| Synonyms | 11-Azaestr-4-En-3-One, 17-Hydroxy-, (17Beta)-; D-11-Aza-19-Nortestosterone |
| Molecular Structure |  |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 |
| CAS Registry Number | 41235-53-4 |
| SMILES | [C@@H]14[C@H](NC[C@]2([C@H]1CC[C@@H]2O)C)[C@@H]3C(=CC(=O)CC3)CC4 |
| InChI | 1S/C17H25NO2/c1-17-9-18-16-12-5-3-11(19)8-10(12)2-4-13(16)14(17)6-7-15(17)20/h8,12-16,18,20H,2-7,9H2,1H3/t12-,13-,14-,15-,16+,17-/m0/s1 |
| InChIKey | WWAGMWYACBCHPT-JNNCMOEMSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.086°C at 760 mmHg (Cal.) |
| Flash point | 226.004°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-11-Aza-19-Nortestosterone |