Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Azapentacyclo[6.4.0.02,10.03,7.09,11]Dodeca-1(12),2,5,7,9(11)-Pentaene |
|---|---|
| Synonyms | 1,7-dihydro-4,6,7-(epimetheno)pentaleno[1,2-b]pyrrole |
| Molecular Structure | ![CAS#: 59350-56-0， 4-Azapentacyclo[6.4.0.0<Sup>2,10</Sup>.0<Sup>3,7</Sup>.0<Sup>9,11</Sup>]Dodeca-1(12),2,5,7,9(11)-Pentaene](/moreStructures/59350-56-0.gif) |
| Molecular Formula | C11H5N |
| Molecular Weight | 151.16 |
| CAS Registry Number | 59350-56-0 |
| SMILES | C1=CNC2=C3C4C5=C4C(=C21)C3=C5 |
| InChI | 1S/C11H5N/c1-2-12-11-4(1)7-5-3-6-8(7)9(6)10(5)11/h1-3,9,12H |
| InChIKey | MMSCDXHGWITRSO-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 728.3±53.0°C at 760 mmHg (Cal.) |
| Flash point | 479.3±26.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Azapentacyclo[6.4.0.02,10.03,7.09,11]Dodeca-1(12),2,5,7,9(11)-Pentaene |