Online Database of Chemicals from Around the World
|
CAS#: 41451-68-7 Product: Steganacin No suppilers available for the product. |
| Name | Steganacin |
|---|---|
| Synonyms | Steganacin; Acon1_001754; (-)-Steganacin |
| Molecular Structure |  |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 |
| CAS Registry Number | 41451-68-7 |
| SMILES | [C@H]45[C@@H](CC1=CC(=C(OC)C(=C1C3=CC2=C(OCO2)C=C3[C@@H]4OC(=O)C)OC)OC)C(OC5)=O |
| InChI | 1S/C24H24O9/c1-11(25)33-21-14-8-18-17(31-10-32-18)7-13(14)20-12(5-15-16(21)9-30-24(15)26)6-19(27-2)22(28-3)23(20)29-4/h6-8,15-16,21H,5,9-10H2,1-4H3/t15-,16+,21+/m1/s1 |
| InChIKey | XJTXBUKLGQCZHC-XFQAVAEZSA-N |
| Density | 1.408g/cm3 (Cal.) |
|---|---|
| Boiling point | 646.873°C at 760 mmHg (Cal.) |
| Flash point | 279.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Steganacin |