Online Database of Chemicals from Around the World
|
CAS#: 41451-71-2 Product: Steganol No suppilers available for the product. |
| Name | Steganol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 |
| CAS Registry Number | 41451-71-2 |
| SMILES | C2=C1OCOC1=CC4=C2C(O)C3C(C(OC3)=O)CC5=CC(=C(OC)C(=C45)OC)OC |
| InChI | 1S/C22H22O8/c1-25-17-5-10-4-13-14(8-28-22(13)24)19(23)12-7-16-15(29-9-30-16)6-11(12)18(10)21(27-3)20(17)26-2/h5-7,13-14,19,23H,4,8-9H2,1-3H3 |
| InChIKey | VLOMFQZOMYZLFI-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 656.114°C at 760 mmHg (Cal.) |
| Flash point | 232.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Steganol |