Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | alpha-L-Xylofuranose |
|---|---|
| Synonyms | (2R,3S,4S,5S)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol; ZINC02556400 |
| Molecular Structure |  |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 41546-30-9 |
| SMILES | O[C@@H]1[C@@H](O[C@@H](O)[C@H]1O)CO |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5+/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-SKNVOMKLSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.36°C at 760 mmHg (Cal.) |
| Flash point | 180.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-L-Xylofuranose |