Online Database of Chemicals from Around the World
|
CAS#: 64913-51-5 Product: Xylitol 5-Phosphate No suppilers available for the product. |
| Name | Xylitol 5-Phosphate |
|---|---|
| Synonyms | L-Xylitol 5-Phosphate; Xylitol 5-P; Xylitol, Mono(Dihydrogen Phosphate) |
| Molecular Structure |  |
| Molecular Formula | C5H13O8P |
| Molecular Weight | 232.13 |
| CAS Registry Number | 64913-51-5 |
| SMILES | [C@@H](O)([C@@H](O)[C@H](O)CO)CO[P](=O)(O)O |
| InChI | 1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/t3-,4+,5+/m1/s1 |
| InChIKey | VJDOAZKNBQCAGE-WISUUJSJSA-N |
| Density | 1.817g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.759°C at 760 mmHg (Cal.) |
| Flash point | 328.619°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Xylitol 5-Phosphate |