Online Database of Chemicals from Around the World
|
CAS#: 41727-53-1 Product: 4-(Allyloxy)-3,5-Dichlorobenzamide No suppilers available for the product. |
| Name | 4-(Allyloxy)-3,5-Dichlorobenzamide |
|---|---|
| Synonyms | 4-Allyloxy-3,5-Dichloro-Benzamide; 4-Allyloxy-3,5-Dichlorobenzamide; 3,5-Dichloro-4-Prop-2-Enoxy-Benzamide |
| Molecular Structure |  |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 |
| CAS Registry Number | 41727-53-1 |
| SMILES | C1=C(C(=C(C=C1C(N)=O)Cl)OCC=C)Cl |
| InChI | 1S/C10H9Cl2NO2/c1-2-3-15-9-7(11)4-6(10(13)14)5-8(9)12/h2,4-5H,1,3H2,(H2,13,14) |
| InChIKey | QAFXHUDHHDQWJD-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.121°C at 760 mmHg (Cal.) |
| Flash point | 144.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Allyloxy)-3,5-Dichlorobenzamide |