|
CAS#: 54139-62-7 Product: N-{[4-(Allyloxy)-3-Chlorophenyl]Acetyl}Glycine No suppilers available for the product. |
| Name | N-{[4-(Allyloxy)-3-Chlorophenyl]Acetyl}Glycine |
|---|---|
| Synonyms | (([4-(Allyloxy)-3-chlorophenyl]acetyl)amino)acetic acid #; (N-Carboxymethyl)-4-allyloxy-3-chlorophenylacetamide; Glycine, N-[[3-chloro-4-(2-propenyloxy)phenyl]acetyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 |
| CAS Registry Number | 54139-62-7 |
| SMILES | Clc1cc(ccc1OC\C=C)CC(=O)NCC(=O)O |
| InChI | 1S/C13H14ClNO4/c1-2-5-19-11-4-3-9(6-10(11)14)7-12(16)15-8-13(17)18/h2-4,6H,1,5,7-8H2,(H,15,16)(H,17,18) |
| InChIKey | HCYTXRRZWZWRFD-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.134°C at 760 mmHg (Cal.) |
| Flash point | 284.092°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-{[4-(Allyloxy)-3-Chlorophenyl]Acetyl}Glycine |