Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Nitrofluoren-9-One |
|---|---|
| Synonyms | 3-Nitro-9-Fluorenone; Wln: L B656 Hvj Enw; 3-Nitro-9-Fluoronone |
| Molecular Structure |  |
| Molecular Formula | C13H7NO3 |
| Molecular Weight | 225.20 |
| CAS Registry Number | 42135-22-8 |
| EINECS | 255-675-6 |
| SMILES | C1=C([N+]([O-])=O)C=CC3=C1C2=CC=CC=C2C3=O |
| InChI | 1S/C13H7NO3/c15-13-10-4-2-1-3-9(10)12-7-8(14(16)17)5-6-11(12)13/h1-7H |
| InChIKey | GLVSVKSIYXDZHY-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.483°C at 760 mmHg (Cal.) |
| Flash point | 228.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrofluoren-9-One |