Online Database of Chemicals from Around the World
|
CAS#: 422-51-5 Product: 1,1,1-Trichloro-2,2,3,3-Tetrafluoropropane No suppilers available for the product. |
| Name | 1,1,1-Trichloro-2,2,3,3-Tetrafluoropropane |
|---|---|
| Synonyms | 1,1,1-Trichloro-2,2,3,3-Tetrafluoro-Propane; Propane, 2,2,3,3-Tetrafluoro-1,1,1-Trichloro-; 2,2,3,3-Tetrafluoro-1,1,1-Trichloropropane |
| Molecular Structure |  |
| Molecular Formula | C3HCl3F4 |
| Molecular Weight | 219.39 |
| CAS Registry Number | 422-51-5 |
| SMILES | C(C(F)(C(Cl)(Cl)Cl)F)(F)F |
| InChI | 1S/C3HCl3F4/c4-3(5,6)2(9,10)1(7)8/h1H |
| InChIKey | LJPLFJPOUHWADA-UHFFFAOYSA-N |
| Density | 1.631g/cm3 (Cal.) |
|---|---|
| Boiling point | 97.957°C at 760 mmHg (Cal.) |
| Flash point | 16.856°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trichloro-2,2,3,3-Tetrafluoropropane |