Online Database of Chemicals from Around the World
|
CAS#: 422-54-8 Product: 1,3,3-Trichloro-1,1,2,2-Tetrafluoropropane No suppilers available for the product. |
| Name | 1,3,3-Trichloro-1,1,2,2-Tetrafluoropropane |
|---|---|
| Synonyms | 1,3,3-Trichloro-1,1,2,2-Tetrafluoro-Propane; Hcfc-224 |
| Molecular Structure |  |
| Molecular Formula | C3HCl3F4 |
| Molecular Weight | 219.39 |
| CAS Registry Number | 422-54-8 |
| EINECS | 207-014-8 |
| SMILES | C(C(F)(C(F)(F)Cl)F)(Cl)Cl |
| InChI | 1S/C3HCl3F4/c4-1(5)2(7,8)3(6,9)10/h1H |
| InChIKey | WWNLOOSSVHRIFJ-UHFFFAOYSA-N |
| Density | 1.631g/cm3 (Cal.) |
|---|---|
| Boiling point | 92.374°C at 760 mmHg (Cal.) |
| Flash point | 13.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trichloro-1,1,2,2-Tetrafluoropropane |