Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | Colitose |
|---|---|
| Synonyms | 3,6-Deoxy-L-Galactose; Chebi:23360 |
| Molecular Structure |  |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 4221-05-0 |
| SMILES | [C@H](C[C@@H](C=O)O)([C@@H](O)C)O |
| InChI | 1S/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6-/m0/s1 |
| InChIKey | GNTQICZXQYZQNE-ZLUOBGJFSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.045°C at 760 mmHg (Cal.) |
| Flash point | 188.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Colitose |