|
CAS#: 42293-72-1 Product: N-Acetyl-3-((2-benzoyl-propyl)thio)alanine No suppilers available for the product. |
| Name | N-Acetyl-3-((2-benzoyl-propyl)thio)alanine |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(2-Methyl-3-Oxo-3-Phenyl-Propyl)Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[(2-Methyl-3-Oxo-3-Phenylpropyl)Thio]Propanoic Acid; (2R)-2-Acetamido-3-[(3-Keto-2-Methyl-3-Phenyl-Propyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.38 |
| CAS Registry Number | 42293-72-1 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CSCC(C)C(C1=CC=CC=C1)=O |
| InChI | 1S/C15H19NO4S/c1-10(14(18)12-6-4-3-5-7-12)8-21-9-13(15(19)20)16-11(2)17/h3-7,10,13H,8-9H2,1-2H3,(H,16,17)(H,19,20)/t10?,13-/m0/s1 |
| InChIKey | FXPSJTKESYQXLX-HQVZTVAUSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.529°C at 760 mmHg (Cal.) |
| Flash point | 303.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-3-((2-benzoyl-propyl)thio)alanine |