|
CAS#: 42418-76-8 Product: cis-2-Aminomethylcycloheptanol Hydrochloride No suppilers available for the product. |
| Name | cis-2-Aminomethylcycloheptanol Hydrochloride |
|---|---|
| Synonyms | [(1S,2S)-2-Hydroxycycloheptyl]Methylammonium; Zinc02570076 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18NO |
| Molecular Weight | 144.24 |
| CAS Registry Number | 42418-76-8 |
| SMILES | [C@@H]1([C@@H](O)CCCCC1)C[NH3+] |
| InChI | 1S/C8H17NO/c9-6-7-4-2-1-3-5-8(7)10/h7-8,10H,1-6,9H2/p+1/t7-,8-/m0/s1 |
| InChIKey | DEEDWZHOSLMVCD-YUMQZZPRSA-O |
| Boiling point | 246.683°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 102.991°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for cis-2-Aminomethylcycloheptanol Hydrochloride |