Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(4-Nitro-1-Piperazinyl)Ethanol |
|---|---|
| Synonyms | 1-Piperazineethanol,4-nitro-; 2-(4-nitropiperazin-1-yl)ethanol |
| Molecular Structure |  |
| Molecular Formula | C6H13N3O3 |
| Molecular Weight | 175.19 |
| CAS Registry Number | 42499-45-6 |
| SMILES | C1CN(CCN1CCO)[N+](=O)[O-] |
| InChI | 1S/C6H13N3O3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h10H,1-6H2 |
| InChIKey | ABAUHEKMEHBEMZ-UHFFFAOYSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.63°C at 760 mmHg (Cal.) |
| Flash point | 183.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Nitro-1-Piperazinyl)Ethanol |