Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Nitro-2,6-piperazinedione |
|---|---|
| Synonyms | 2,6-Piperazinedione, 4-nitro-; 4-Nitro-2,6-piperazindion; 4-Nitro-2,6-piperazinedione |
| Molecular Structure |  |
| Molecular Formula | C4H5N3O4 |
| Molecular Weight | 159.10 |
| CAS Registry Number | 860765-20-4 |
| SMILES | C1C(=O)NC(=O)CN1[N+](=O)[O-] |
| InChI | 1S/C4H5N3O4/c8-3-1-6(7(10)11)2-4(9)5-3/h1-2H2,(H,5,8,9) |
| InChIKey | NVZYYZPTSDNRQJ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.9±39.0°C at 760 mmHg (Cal.) |
| Flash point | 287.5±27.1°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-2,6-piperazinedione |