Online Database of Chemicals from Around the World
|
CAS#: 4253-80-9 Product: 3-(2-Nitrophenyl)Pyridine No suppilers available for the product. |
| Name | 3-(2-Nitrophenyl)Pyridine |
|---|---|
| Synonyms | 3-(2-nitrophenyl)pyridine; Pyridine, 3-(2-nitrophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 4253-80-9 |
| SMILES | [O-][N+](=O)c1ccccc1c2cccnc2 |
| InChI | 1S/C11H8N2O2/c14-13(15)11-6-2-1-5-10(11)9-4-3-7-12-8-9/h1-8H |
| InChIKey | ZPJOXBZQFCRKER-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.358°C at 760 mmHg (Cal.) |
| Flash point | 164.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Nitrophenyl)Pyridine |