|
CAS#: 912772-97-5 Product: 5-Nitro-6-phenyl-2-pyridinamine No suppilers available for the product. |
| Name | 5-Nitro-6-phenyl-2-pyridinamine |
|---|---|
| Synonyms | 2-Amino-5-nitro-6-phenylpyridine; 5-nitro-6-phenyl-2-pyridylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 |
| CAS Registry Number | 912772-97-5 |
| SMILES | c1ccc(cc1)c2c(ccc(n2)N)[N+](=O)[O-] |
| InChI | 1S/C11H9N3O2/c12-10-7-6-9(14(15)16)11(13-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13) |
| InChIKey | CLKRMIVNRORWRC-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.694°C at 760 mmHg (Cal.) |
| Flash point | 214.881°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-6-phenyl-2-pyridinamine |