Online Database of Chemicals from Around the World
|
CAS#: 42595-18-6 Product: 1-(3-Chlorophenyl)-3-Chloro-1H-Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 1-(3-Chlorophenyl)-3-Chloro-1H-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 3-Chloro-1-(3-Chlorophenyl)-3-Pyrroline-2,5-Quinone; 1H-Pyrrole-2,5-Dione, 3-Chloro-1-(3-Chlorophenyl)-; Maleimide, 2-Chloro-N-(M-Chlorophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.06 |
| CAS Registry Number | 42595-18-6 |
| SMILES | C1=C(C=CC=C1N2C(C=C(C2=O)Cl)=O)Cl |
| InChI | 1S/C10H5Cl2NO2/c11-6-2-1-3-7(4-6)13-9(14)5-8(12)10(13)15/h1-5H |
| InChIKey | VAPQHSHEGBPFDF-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.873°C at 760 mmHg (Cal.) |
| Flash point | 171.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Chlorophenyl)-3-Chloro-1H-Pyrrole-2,5-Dione |