| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 4-Chlorophenyl chlorothionoformate |
|---|---|
| Synonyms | Chloromethanethioic Acid O-(4-Chlorophenyl) Ester; Inchi=1/C7h4cl2os/C8-5-1-3-6(4-2-5)10-7(9)11/H1-4; O-(4-Chlorophenyl) Chloridothiocarbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4Cl2OS |
| Molecular Weight | 207.07 |
| CAS Registry Number | 937-64-4 |
| EINECS | 213-334-9 |
| SMILES | C1=C(C=CC(=C1)Cl)OC(=S)Cl |
| InChI | 1S/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
| InChIKey | BQIABQCJXBELMT-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.7±13.0°C at 760 mmHg (Cal.) |
| 278.5551-281.3279°C (Expl.) | |
| Flash point | 100°C (Expl.) |
| 106.0±19.8°C (Cal.) | |
| Refractive index | 1.595 (Expl.) |
| Safety Description | CORROSIVE |
|---|---|
| DANGER: CORROSIVE, burns skin and eyes | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenyl chlorothionoformate |