Online Database of Chemicals from Around the World
|
CAS#: 42599-89-3 Product: Chrysogine No suppilers available for the product. |
| Name | Chrysogine |
|---|---|
| Synonyms | Chrysogine; Nsc708217 |
| Molecular Structure |  |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 42599-89-3 |
| SMILES | C2=C1NC(=NC(=O)C1=CC=C2)C(O)C |
| InChI | 1S/C10H10N2O2/c1-6(13)9-11-8-5-3-2-4-7(8)10(14)12-9/h2-6,13H,1H3,(H,11,12,14) |
| InChIKey | BMBSGGZMJQTQSO-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.188°C at 760 mmHg (Cal.) |
| Flash point | 175.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chrysogine |