Online Database of Chemicals from Around the World
|
CAS#: 94255-53-5 Product: 6-Chrysenylisothiocyanate No suppilers available for the product. |
| Name | 6-Chrysenylisothiocyanate |
|---|---|
| Synonyms | Ccris 6853; 6-Chrysenyl Isothiocyanate |
| Molecular Structure |  |
| Molecular Formula | C19H11NS |
| Molecular Weight | 285.36 |
| CAS Registry Number | 94255-53-5 |
| SMILES | S=C=NC2=C1C=CC=CC1=C4C(=C2)C3=CC=CC=C3C=C4 |
| InChI | 1S/C19H11NS/c21-12-20-19-11-18-14-6-2-1-5-13(14)9-10-16(18)15-7-3-4-8-17(15)19/h1-11H |
| InChIKey | CIAHPHFXCYGAPB-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.849°C at 760 mmHg (Cal.) |
| Flash point | 298.922°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chrysenylisothiocyanate |