Online Database of Chemicals from Around the World
|
CAS#: 42834-66-2 Product: 2-Oxo-2-(9-oxo-2-fluorenyl)acetaldehyde No suppilers available for the product. |
| Name | 2-Oxo-2-(9-oxo-2-fluorenyl)acetaldehyde |
|---|---|
| Synonyms | 2-Oxo-2-(9-Oxo-2-Fluorenyl)Acetaldehyde; 2-Keto-2-(9-Ketofluoren-2-Yl)Acetaldehyde; 2-Oxo-2-(9-Oxofluoren-2-Yl)Ethanal |
| Molecular Structure |  |
| Molecular Formula | C15H8O3 |
| Molecular Weight | 236.23 |
| CAS Registry Number | 42834-66-2 |
| SMILES | C1=CC2=C(C=C1C(C=O)=O)C(=O)C3=CC=CC=C23 |
| InChI | 1S/C15H8O3/c16-8-14(17)9-5-6-11-10-3-1-2-4-12(10)15(18)13(11)7-9/h1-8H |
| InChIKey | ZABSXKJOMUONGB-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.703°C at 760 mmHg (Cal.) |
| Flash point | 193.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-2-(9-oxo-2-fluorenyl)acetaldehyde |