Online Database of Chemicals from Around the World
|
CAS#: 77694-38-3 Product: N-(2-Oxooxolan-3-Yl)Thiophene-2-Carboxamide No suppilers available for the product. |
| Name | N-(2-Oxooxolan-3-Yl)Thiophene-2-Carboxamide |
|---|---|
| Synonyms | N-(2-Oxotetrahydrofuran-3-Yl)Thiophene-2-Carboxamide; N-(2-Oxo-3-Tetrahydrofuranyl)-2-Thiophenecarboxamide; N-(2-Ketotetrahydrofuran-3-Yl)Thiophene-2-Carboxamide |
| Molecular Structure |  |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 |
| CAS Registry Number | 77694-38-3 |
| SMILES | C1=C(SC=C1)C(=O)NC2C(OCC2)=O |
| InChI | 1S/C9H9NO3S/c11-8(7-2-1-5-14-7)10-6-3-4-13-9(6)12/h1-2,5-6H,3-4H2,(H,10,11) |
| InChIKey | OYCHNKSWYZRTLV-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.95°C at 760 mmHg (Cal.) |
| Flash point | 275.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Oxooxolan-3-Yl)Thiophene-2-Carboxamide |