Online Database of Chemicals from Around the World
|
CAS#: 4302-88-9 Product: 4-Nitromethamphetamine No suppilers available for the product. |
| Name | 4-Nitromethamphetamine |
|---|---|
| Synonyms | Methyl-[1-Methyl-2-(4-Nitrophenyl)Ethyl]Amine; 4-Nitromethylamphetamine; Benzeneethanamine, N,Alpha-Dimethyl-4-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 |
| CAS Registry Number | 4302-88-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)CC(NC)C |
| InChI | 1S/C10H14N2O2/c1-8(11-2)7-9-3-5-10(6-4-9)12(13)14/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | FMYSLOHXMJLTRT-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.805°C at 760 mmHg (Cal.) |
| Flash point | 141.77°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitromethamphetamine |