|
CAS#: 4325-74-0 Product: 1,2'-Binaphthalene No suppilers available for the product. |
| Name | 1,2'-Binaphthalene |
|---|---|
| Synonyms | 1-(2-Naphthyl)Naphthalene; 1,2'-Binaphthyl; Nsc30993 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 |
| CAS Registry Number | 4325-74-0 |
| SMILES | C1=CC=C4C(=C1C2=CC3=C(C=C2)C=CC=C3)C=CC=C4 |
| InChI | 1S/C20H14/c1-2-8-17-14-18(13-12-15(17)6-1)20-11-5-9-16-7-3-4-10-19(16)20/h1-14H |
| InChIKey | CFPMTYLOUSWLLM-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.811°C at 760 mmHg (Cal.) |
| Flash point | 199.131°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2'-Binaphthalene |