Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | [1,1'-Binaphthalene]-4,4'-diamine |
|---|---|
| Synonyms | 4-(4-Amino-1-Naphthyl)Naphthalen-1-Amine; 4-(4-Amino-1-Naphthyl)-1-Naphthalenamine; [4-(4-Amino-1-Naphthyl)-1-Naphthyl]Amine |
| Molecular Structure | ![CAS#: 481-91-4， [1,1'-Binaphthalene]-4,4'-diamine](/moreStructures/481-91-4.gif) |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 |
| CAS Registry Number | 481-91-4 |
| EINECS | 207-574-3 |
| SMILES | C1=CC(=C4C(=C1C2=C3C(=C(N)C=C2)C=CC=C3)C=CC=C4)N |
| InChI | 1S/C20H16N2/c21-19-11-9-15(13-5-1-3-7-17(13)19)16-10-12-20(22)18-8-4-2-6-14(16)18/h1-12H,21-22H2 |
| InChIKey | RZPBZEISZUFQSV-UHFFFAOYSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.941°C at 760 mmHg (Cal.) |
| Flash point | 290.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1,1'-Binaphthalene]-4,4'-diamine |