Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Pentorex |
|---|---|
| Synonyms | 2-Methyl-3-Phenyl-Butan-2-Amine; (1,1-Dimethyl-2-Phenyl-Propyl)Amine; 2-Amino-2-Methyl-3-Phenylbutane |
| Molecular Structure |  |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 |
| CAS Registry Number | 434-43-5 |
| EINECS | 207-102-6 |
| SMILES | C1=C(C(C(C)(C)N)C)C=CC=C1 |
| InChI | 1S/C11H17N/c1-9(11(2,3)12)10-7-5-4-6-8-10/h4-9H,12H2,1-3H3 |
| InChIKey | UMWAUEZOGHNSCH-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.3±9.0°C at 760 mmHg (Cal.) |
| Flash point | 96.5±9.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentorex |