| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Circulatory system medication >> Angiotensin converting enzyme and receptor inhibitor |
|---|---|
| Name | Pentopril |
| Synonyms | (2R)-1-[(2R,4R)-5-Ethoxy-2,4-Dimethyl-5-Oxo-Pentanoyl]Indoline-2-Carboxylic Acid; (2R)-1-[(2R,4R)-5-Ethoxy-2,4-Dimethyl-1,5-Dioxopentyl]-2-Indolinecarboxylic Acid; (2R)-1-[(2R,4R)-5-Ethoxy-5-Keto-2,4-Dimethyl-Pentanoyl]Indoline-2-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 |
| CAS Registry Number | 82924-03-6 |
| SMILES | [C@H]1(N(C2=C(C1)C=CC=C2)C([C@@H](C[C@H](C(OCC)=O)C)C)=O)C(O)=O |
| InChI | 1S/C18H23NO5/c1-4-24-18(23)12(3)9-11(2)16(20)19-14-8-6-5-7-13(14)10-15(19)17(21)22/h5-8,11-12,15H,4,9-10H2,1-3H3,(H,21,22)/t11-,12-,15-/m1/s1 |
| InChIKey | NVXFXLSOGLFXKQ-LALPHHSUSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.133°C at 760 mmHg (Cal.) |
| Flash point | 293.767°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentopril |