|
CAS#: 435345-15-6 Product: 1-Ethylsulfonyl-Piperazine No suppilers available for the product. |
| Name | 1-Ethylsulfonyl-Piperazine |
|---|---|
| Synonyms | Zinc00356407 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15N2O2S |
| Molecular Weight | 179.26 |
| CAS Registry Number | 435345-15-6 |
| SMILES | C([S](=O)(=O)N1CC[NH2+]CC1)C |
| InChI | 1S/C6H14N2O2S/c1-2-11(9,10)8-5-3-7-4-6-8/h7H,2-6H2,1H3/p+1 |
| InChIKey | BIYGAOBOLDXNHM-UHFFFAOYSA-O |
| Boiling point | 294.489°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 131.902°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Ethylsulfonyl-Piperazine |