Online Database of Chemicals from Around the World
|
CAS#: 94231-70-6 Product: (4-ethylsulfonylphenyl)-phenyl-methanol No suppilers available for the product. |
| Name | (4-ethylsulfonylphenyl)-phenyl-methanol |
|---|---|
| Synonyms | 4-(ethylsulphonyl)benzhydryl alcohol |
| Molecular Structure |  |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.35 |
| CAS Registry Number | 94231-70-6 |
| EINECS | 303-890-1 |
| SMILES | OC(c1ccccc1)c2ccc(cc2)S(=O)(=O)CC |
| InChI | 1S/C15H16O3S/c1-2-19(17,18)14-10-8-13(9-11-14)15(16)12-6-4-3-5-7-12/h3-11,15-16H,2H2,1H3 |
| InChIKey | ABOZFWQFQKINJF-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.383°C at 760 mmHg (Cal.) |
| Flash point | 244.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-ethylsulfonylphenyl)-phenyl-methanol |