Online Database of Chemicals from Around the World
|
CAS#: 4414-76-0 Product: 1H-Indole-3-Propiononitrile No suppilers available for the product. |
| Name | 1H-Indole-3-Propiononitrile |
|---|---|
| Synonyms | 3-(1H-Indol-3-Yl)Propionitrile; Stk089710; 1H-Indole-3-Propanenitrile |
| Molecular Structure |  |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 |
| CAS Registry Number | 4414-76-0 |
| EINECS | 224-572-8 |
| SMILES | C1=CC=CC2=C1C(=C[NH]2)CCC#N |
| InChI | 1S/C11H10N2/c12-7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4H2 |
| InChIKey | QZBSQJAILQLCJF-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 1H-Indole-3-Propiononitrile |