Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1H-Indole-2-sulfonamide |
|---|---|
| Synonyms | 1H-Indole-2-sulfonic acid amide |
| Molecular Structure |  |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 |
| CAS Registry Number | 85953-41-9 |
| SMILES | C1=CC=C2C(=C1)C=C(N2)S(=O)(=O)N |
| InChI | 1S/C8H8N2O2S/c9-13(11,12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H2,9,11,12) |
| InChIKey | RYMYQAMZUWJAEO-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.8±37.0°C at 760 mmHg (Cal.) |
| Flash point | 240.9±26.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indole-2-sulfonamide |