Online Database of Chemicals from Around the World
|
CAS#: 4528-34-1 Product: 2-Nitroethanol Nitrate No suppilers available for the product. |
| Name | 2-Nitroethanol Nitrate |
|---|---|
| Synonyms | Ethanol, 2-Nitro-, Nitrate (Ester); Nitroethyl Nitrate [Forbidden]; 2-Nitroethyl Nitrate |
| Molecular Structure |  |
| Molecular Formula | C2H4N2O5 |
| Molecular Weight | 136.06 |
| CAS Registry Number | 4528-34-1 |
| SMILES | C(O[N+]([O-])=O)C[N+]([O-])=O |
| InChI | 1S/C2H4N2O5/c5-3(6)1-2-9-4(7)8/h1-2H2 |
| InChIKey | FRXFYZJACNONHT-UHFFFAOYSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.208°C at 760 mmHg (Cal.) |
| Flash point | 129.283°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitroethanol Nitrate |