|
CAS#: 4604-49-3 Product: 5-Methyl-5-Nitrohexan-2-One No suppilers available for the product. |
| Name | 5-Methyl-5-Nitrohexan-2-One |
|---|---|
| Synonyms | 5-Methyl-5-Nitro-Hexan-2-One; 2-Hexanone, 5-Methyl-5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 |
| CAS Registry Number | 4604-49-3 |
| EINECS | 225-006-2 |
| SMILES | C(C([N+]([O-])=O)(C)C)CC(C)=O |
| InChI | 1S/C7H13NO3/c1-6(9)4-5-7(2,3)8(10)11/h4-5H2,1-3H3 |
| InChIKey | QWHNMIXUSPUHGO-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.952°C at 760 mmHg (Cal.) |
| Flash point | 103.317°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-5-Nitrohexan-2-One |