Online Database of Chemicals from Around the World
|
CAS#: 7251-87-8 Product: 5-Methyl-5-Nitro-Hexan-2-Ol No suppilers available for the product. |
| Name | 5-Methyl-5-Nitro-Hexan-2-Ol |
|---|---|
| Synonyms | 5-Methyl-5-Nitro-Hexan-2-Ol; Nsc20680 |
| Molecular Structure |  |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 |
| CAS Registry Number | 7251-87-8 |
| SMILES | C(C(C)O)CC(C)(C)[N+]([O-])=O |
| InChI | 1S/C7H15NO3/c1-6(9)4-5-7(2,3)8(10)11/h6,9H,4-5H2,1-3H3 |
| InChIKey | JHAZSFLGWSANGV-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.611°C at 760 mmHg (Cal.) |
| Flash point | 101.93°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-5-Nitro-Hexan-2-Ol |