|
CAS#: 4614-69-1 Product: 1-Phenanthrenecarboxylic Acid No suppilers available for the product. |
| Name | 1-Phenanthrenecarboxylic Acid |
|---|---|
| Synonyms | 1-Phenanthrenecarboxylic acid; PHENANTHRENE-1-CARBOXYLIC ACID; NSC139679 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 4614-69-1 |
| SMILES | O=C(O)c2c1ccc3c(c1ccc2)cccc3 |
| InChI | 1S/C15H10O2/c16-15(17)14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H,(H,16,17) |
| InChIKey | KFDKNTQGTAEZGC-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.48°C at 760 mmHg (Cal.) |
| Flash point | 206.075°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenanthrenecarboxylic Acid |