Online Database of Chemicals from Around the World
|
CAS#: 63018-89-3 Product: Phenanthrene-3,4-Dicarboxylic Acid No suppilers available for the product. |
| Name | Phenanthrene-3,4-Dicarboxylic Acid |
|---|---|
| Synonyms | 3,4-Phenanthrenedicarboxylic Acid; Nsc26995 |
| Molecular Structure |  |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 63018-89-3 |
| SMILES | C1=CC3=C(C(=C1C(=O)O)C(O)=O)C2=C(C=CC=C2)C=C3 |
| InChI | 1S/C16H10O4/c17-15(18)12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)14(12)16(19)20/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | IZXDSGJZIWWWKG-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.147°C at 760 mmHg (Cal.) |
| Flash point | 289.706°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthrene-3,4-Dicarboxylic Acid |