Online Database of Chemicals from Around the World
|
CAS#: 47107-74-4 Product: Iodo(Triphenylphosphino)Copper No suppilers available for the product. |
| Name | Iodo(Triphenylphosphino)Copper |
|---|---|
| Synonyms | Iodo(Triphenylphosphino)Copper |
| Molecular Structure |  |
| Molecular Formula | C18H15CuIP |
| Molecular Weight | 452.74 |
| CAS Registry Number | 47107-74-4 |
| EINECS | 256-296-9 |
| SMILES | [Cu+].P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |
| InChI | 1S/C18H15P.Cu.HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;1H/q;+1;/p-1 |
| InChIKey | DKGJFOQMRCRRSL-UHFFFAOYSA-M |
| Boiling point | 360°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iodo(Triphenylphosphino)Copper |