|
CAS#: 934388-22-4 Product: 4-Iodo-1-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine No suppilers available for the product. |
| Name | 4-Iodo-1-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonyms | 1H-Pyrrolo[2,3-b]pyridine, 4-iodo-1-(trimethylsilyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13IN2Si |
| Molecular Weight | 316.21 |
| CAS Registry Number | 934388-22-4 |
| SMILES | C[Si](C)(C)n1ccc2c1nccc2I |
| InChI | 1S/C10H13IN2Si/c1-14(2,3)13-7-5-8-9(11)4-6-12-10(8)13/h4-7H,1-3H3 |
| InChIKey | DWAWRLFPOXHKNA-UHFFFAOYSA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.682°C at 760 mmHg (Cal.) |
| Flash point | 120.529°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Iodo-1-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine |