Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Ethyl 4-Methyl 1H-Indole-2,4-Dicarboxylate |
|---|---|
| Synonyms | 4-Methoxycarbonylindole-2-carboxylic acidethyl ester; INDOLE-2,4-DICARBOXYLIC ACID 2-ETHYL 4-METHYL ESTER; Indole-2,4-dicarboxylic acid 2-ethyl ester 4-methyl ester |
| Molecular Structure |  |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 |
| CAS Registry Number | 473883-20-4 |
| SMILES | CCOC(=O)c1cc2c(cccc2[nH]1)C(=O)OC |
| InChI | 1S/C13H13NO4/c1-3-18-13(16)11-7-9-8(12(15)17-2)5-4-6-10(9)14-11/h4-7,14H,3H2,1-2H3 |
| InChIKey | FQDHGBXAWBUTQW-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.821°C at 760 mmHg (Cal.) |
| Flash point | 201.653°C (Cal.) |
| Refractive index | 1.603 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl 4-Methyl 1H-Indole-2,4-Dicarboxylate |