Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 7-methyl-1H-indole-3-carboxylate |
|---|---|
| Synonyms | Ethyl 7-methylindole-3-carboxylate; ethyl7-methyl-1H-indole-3-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 773128-82-8 |
| SMILES | CCOC(=O)c1c[nH]c2c1cccc2C |
| InChI | 1S/C12H13NO2/c1-3-15-12(14)10-7-13-11-8(2)5-4-6-9(10)11/h4-7,13H,3H2,1-2H3 |
| InChIKey | BIOFSBISOZTVAU-UHFFFAOYSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.91°C at 760 mmHg (Cal.) |
| Flash point | 166.025°C (Cal.) |
| Refractive index | 1.609 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 7-methyl-1H-indole-3-carboxylate |