Online Database of Chemicals from Around the World
|
CAS#: 478-88-6 Product: Ergoline No suppilers available for the product. |
| Name | Ergoline |
|---|---|
| Synonyms | Ergoline |
| Molecular Structure |  |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 478-88-6 |
| SMILES | C1=CC=C3C2=C1C4C(CC2=C[NH]3)NCCC4 |
| InChI | 1S/C14H16N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1,3,5,8,10,13,15-16H,2,4,6-7H2 |
| InChIKey | RHGUXDUPXYFCTE-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.292°C at 760 mmHg (Cal.) |
| Flash point | 210.404°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ergoline |