Online Database of Chemicals from Around the World
|
CAS#: 20780-41-0 Product: (3b)-Ergosta-5,24-dien-3-ol No suppilers available for the product. |
| Name | (3b)-Ergosta-5,24-dien-3-ol |
|---|---|
| Synonyms | (3S,8S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-[(1R)-1,4,5-Trimethylhex-4-Enyl]-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; 24-Methyldesmosterol; Ergosta-5,24-Dien-3-Ol, (3Beta)- |
| Molecular Structure |  |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.67 |
| CAS Registry Number | 20780-41-0 |
| SMILES | [C@]24([C@H]([C@@H]1CC=C3[C@@]([C@H]1CC2)(CC[C@H](O)C3)C)CC[C@@H]4[C@@H](CCC(=C(C)C)C)C)C |
| InChI | 1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,20,22-26,29H,7-8,10-17H2,1-6H3/t20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | YTFTXKBJICNYCV-PXBBAZSNSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.051°C at 760 mmHg (Cal.) |
| Flash point | 215.754°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3b)-Ergosta-5,24-dien-3-ol |