Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | cis,cis,trans-1,2,4-Trimethylcyclopentane |
|---|---|
| Synonyms | 1,Cis-3,Cis-4-Trimethylcyclopentane; 1,Cis-3,Cis-4-Trimethylcyclohexane; 1,Cis-2,Trans-4-Trimethylcyclopentane |
| Molecular Structure |  |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.21 |
| CAS Registry Number | 4850-28-6 |
| EINECS | 225-441-8 |
| SMILES | [C@H]1([C@@H](CC(C1)C)C)C |
| InChI | 1S/C8H16/c1-6-4-7(2)8(3)5-6/h6-8H,4-5H2,1-3H3/t6?,7-,8+ |
| InChIKey | PNUFYSGVPVMNRN-IEESLHIDSA-N |
| Density | 0.755g/cm3 (Cal.) |
|---|---|
| Boiling point | 116.338°C at 760 mmHg (Cal.) |
| Flash point | 9.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis,cis,trans-1,2,4-Trimethylcyclopentane |