Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
|
+7 (906) 781-2021 | |||
|
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 3,5,5-Trimethylcyclohexyl Propionate |
|---|---|
| Synonyms | Propanoic Acid (3,3,5-Trimethylcyclohexyl) Ester; Propionic Acid (3,3,5-Trimethylcyclohexyl) Ester; 3,5,5-Trimethylcyclohexyl Propionate |
| Molecular Structure |  |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 94021-79-1 |
| EINECS | 301-470-2 |
| SMILES | C(C)C(=O)OC1CC(CC(C1)(C)C)C |
| InChI | 1S/C12H22O2/c1-5-11(13)14-10-6-9(2)7-12(3,4)8-10/h9-10H,5-8H2,1-4H3 |
| InChIKey | YVDQNZNDUJCCJU-UHFFFAOYSA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.643°C at 760 mmHg (Cal.) |
| Flash point | 93.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,5-Trimethylcyclohexyl Propionate |