| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Antiparasitic drug >> Anti-amebiasis and anti-trichomoniasis drugs |
|---|---|
| Name | Dehydroemetine |
| Synonyms | Nsc 131546; Ro 1-9334; Aids-003623 |
| Molecular Structure | ![]() |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 |
| CAS Registry Number | 4914-30-1 |
| EINECS | 225-542-7 |
| SMILES | [C@H]23C1=CC(=C(C=C1CCN2CC(=C(C3)C[C@@H]5C4=C(C=C(C(=C4)OC)OC)CCN5)CC)OC)OC |
| InChI | 1S/C29H38N2O4/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24/h13-16,24-25,30H,6-12,17H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | XXLZPUYGHQWHRN-RPBOFIJWSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.7±55.0°C at 760 mmHg (Cal.) |
| Flash point | 319.5±31.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydroemetine |