|
CAS#: 494763-20-1 Product: 5-[(4-Chlorophenyl)Sulfonyl]-2-(Propylsulfanyl)-1,3-Thiazol-4-Amine No suppilers available for the product. |
| Name | 5-[(4-Chlorophenyl)Sulfonyl]-2-(Propylsulfanyl)-1,3-Thiazol-4-Amine |
|---|---|
| Synonyms | (propylthio)thiazole; 4-Amino-5-(4-chlorophenylsulfonyl)-2-; 4-AMINO-5-(4-CHLOROPHENYLSULFONYL)-2-(PROPYLTHIO)THIAZOLE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13ClN2O2S3 |
| Molecular Weight | 348.89 |
| CAS Registry Number | 494763-20-1 |
| SMILES | Clc1ccc(cc1)S(=O)(=O)c2sc(SCCC)nc2N |
| InChI | 1S/C12H13ClN2O2S3/c1-2-7-18-12-15-10(14)11(19-12)20(16,17)9-5-3-8(13)4-6-9/h3-6H,2,7,14H2,1H3 |
| InChIKey | QVJFIQKKFBSHPQ-UHFFFAOYSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.555°C at 760 mmHg (Cal.) |
| Flash point | 292.209°C (Cal.) |
| Refractive index | 1.677 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(4-Chlorophenyl)Sulfonyl]-2-(Propylsulfanyl)-1,3-Thiazol-4-Amine |